Table of Contents
- 1 What is the correct structure of 4 Ethyl 2 3 Dimethylhexane?
- 2 What is the correct structure of 4 Ethyl 2 Methylheptane?
- 3 What is the structure of 2 4 Dimethylhexane?
- 4 What is the molecular formula of 4 Ethyl 2 3 Dimethylheptane?
- 5 What is the structure of 4 Ethyl 3 Methyloctane?
- 6 What is the structure of 2 ethyl 3 methyl pentane?
What is the correct structure of 4 Ethyl 2 3 Dimethylhexane?
4-Ethyl-2,3-dimethylhexane | C10H22 | ChemSpider.
What is the correct structure of 4 Ethyl 2 Methylheptane?
Identification of (4S)-4-ethyl-2-methylheptane Chemical Compound
Chemical Formula | C10H22 |
---|---|
IUPAC Name | (4S)-4-ethyl-2-methylheptane |
SMILES String | CCCC(CC)CC(C)C |
InChI | InChI=1S/C10H22/c1-5-7-10(6-2)8-9(3)4/h9-10H,5-8H2,1-4H3/t10-/m0/s1 |
InChIKey | OJDKRASKNKPYDH-JTQLQIEISA-N |
What is the structure of 4 Ethyl?
4-Ethyl-1-hexene
PubChem CID | 123365 |
---|---|
Structure | Find Similar Structures |
Molecular Formula | C8H16 |
Synonyms | 4-Ethyl-1-hexene 4-ethylhex-1-ene 1-Hexene, 4-ethyl- 16746-85-3 CHEBI:87523 More… |
Molecular Weight | 112.21 |
What is the structural formula for 2 2 Dimethylhexane?
C8H18
2,2-dimethylhexane/Formula
What is the structure of 2 4 Dimethylhexane?
2,4-Dimethylhexane/Formula
What is the molecular formula of 4 Ethyl 2 3 Dimethylheptane?
4-ethyl-2,3-dimethylheptane
Common Name | 4-ethyl-2,3-dimethylheptane | |
---|---|---|
CAS Number | 61868-22-2 | Molecular Weight |
Density | N/A | Boiling Point |
Molecular Formula | C11H24 | Melting Point |
MSDS | N/A | Flash Point |
What is the line formula for 4-ethyl-2-Methylhexane?
Formula of 4-Ethyl-2-methylhexane (C9H20)
What is the structural formula of 4 Ethyl 3 Methylheptane?
C10H22
4-Ethyl-3-methylheptane | C10H22 | ChemSpider.
What is the structure of 4 Ethyl 3 Methyloctane?
Octane, 4-ethyl-3-methyl
PubChem CID | 530232 |
---|---|
Structure | Find Similar Structures |
Molecular Formula | C11H24 |
Synonyms | Octane, 4-ethyl-3-methyl 4-ethyl-3-methyloctane DTXSID30336228 62016-20-0 |
Molecular Weight | 156.31 |
What is the structure of 2 ethyl 3 methyl pentane?
2-methyl-3-ethylpentane | C8H18 | ChemSpider.
How many methylene ch2 groups are in 2 4-Dimethylhexane?
4 methyl groups
The given compound is 2,4-dimethyl hexane. Its structure is given below: As we can see from the above structure, there are 4 methyl groups in …
What is the structural formula of 2/3 Dimethylhexane?
2,3-Dimethylhexane/Formula